C31H24BrIN2O3S — CID 99664085
(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 99664085) has the molecular formula C31H24BrIN2O3S and a molecular weight of 711.42 g/mol. Its IUPAC name is (5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 99664085 |
| Molecular Formula | C31H24BrIN2O3S |
| Molecular Weight | 711.42 g/mol |
| Exact Mass | 709.97 |
| IUPAC Name | (5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\S/C(=N\c3ccccc3)N(c3ccccc3)C2=O)cc(I)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C31H24BrIN2O3S/c1-2-37-27-18-22(17-26(33)29(27)38-20-21-13-15-23(32)16-14-21)19-28-30(36)35(25-11-7-4-8-12-25)31(39-28)34-24-9-5-3-6-10-24/h3-19H,2,20H2,1H3/b28-19-,34-31- |
| InChIKey | GZPQSGUWGQICEB-AJTBBRNYSA-N |
| XLogP | 8.84 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.42 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|