C28H24BrIN2O5S — CID 6208755
methyl 4-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 6208755) has the molecular formula C28H24BrIN2O5S and a molecular weight of 707.38 g/mol. Its IUPAC name is methyl 4-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 6208755 |
| Molecular Formula | C28H24BrIN2O5S |
| Molecular Weight | 707.38 g/mol |
| Exact Mass | 705.96 |
| IUPAC Name | methyl 4-[[(5Z)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3ccc(C(=O)OC)cc3)N(C)C2=O)cc(I)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H24BrIN2O5S/c1-4-36-23-14-18(13-22(30)25(23)37-16-17-5-9-20(29)10-6-17)15-24-26(33)32(2)28(38-24)31-21-11-7-19(8-12-21)27(34)35-3/h5-15H,4,16H2,1-3H3/b24-15-,31-28+ |
| InChIKey | LFQKEKNENKHKLM-HEDWIIGZSA-N |
| XLogP | 7.05 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.38 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|