C29H28N2O3S — CID 126086742
(5E)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126086742) has the molecular formula C29H28N2O3S and a molecular weight of 484.62 g/mol. Its IUPAC name is (5E)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126086742 |
| Molecular Formula | C29H28N2O3S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (5E)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cc(/C=C2/S/C(=N\c3ccccc3)N(c3ccccc3)C2=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C29H28N2O3S/c1-4-13-22-18-21(19-25(33-5-2)27(22)34-6-3)20-26-28(32)31(24-16-11-8-12-17-24)29(35-26)30-23-14-9-7-10-15-23/h4,7-12,14-20H,1,5-6,13H2,2-3H3/b26-20+,30-29- |
| InChIKey | NLRKGRLQCFXXLT-GTRXGASASA-N |
| XLogP | 7.02 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|