C24H19NO6S2 — CID 50871461
[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 50871461) has the molecular formula C24H19NO6S2 and a molecular weight of 481.55 g/mol. Its IUPAC name is [4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 50871461 |
| Molecular Formula | C24H19NO6S2 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | [4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(/C=C2/SC(=O)N(c3ccccc3)C2=O)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H19NO6S2/c1-16-8-11-19(12-9-16)33(28,29)31-20-13-10-17(14-21(20)30-2)15-22-23(26)25(24(27)32-22)18-6-4-3-5-7-18/h3-15H,1-2H3/b22-15+ |
| InChIKey | UTSDBVADNSHKEM-PXLXIMEGSA-N |
| XLogP | 5.01 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|