C23H16ClNO5S3 — CID 50871576
[4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] benzenesulfonate (PubChem CID 50871576) has the molecular formula C23H16ClNO5S3 and a molecular weight of 518.04 g/mol. Its IUPAC name is [4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] benzenesulfonate.
| Compound Name | [4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 50871576 |
| Molecular Formula | C23H16ClNO5S3 |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 516.99 |
| IUPAC Name | [4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] benzenesulfonate |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3cccc(Cl)c3)C2=O)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H16ClNO5S3/c1-29-20-12-15(10-11-19(20)30-33(27,28)18-8-3-2-4-9-18)13-21-22(26)25(23(31)32-21)17-7-5-6-16(24)14-17/h2-14H,1H3/b21-13+ |
| InChIKey | SXEIUHJQMLIQTK-FYJGNVAPSA-N |
| XLogP | 5.52 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|