C24H17ClN2O7S3 — CID 126349128
[4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate (PubChem CID 126349128) has the molecular formula C24H17ClN2O7S3 and a molecular weight of 577.06 g/mol. Its IUPAC name is [4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate.
| Compound Name | [4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 126349128 |
| Molecular Formula | C24H17ClN2O7S3 |
| Molecular Weight | 577.06 g/mol |
| Exact Mass | 575.99 |
| IUPAC Name | [4-[(E)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3cccc(Cl)c3)C2=O)ccc1OS(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H17ClN2O7S3/c1-14-6-8-18(13-19(14)27(29)30)37(31,32)34-20-9-7-15(10-21(20)33-2)11-22-23(28)26(24(35)36-22)17-5-3-4-16(25)12-17/h3-13H,1-2H3/b22-11+ |
| InChIKey | FYJWWZXROSMLBH-SSDVNMTOSA-N |
| XLogP | 5.74 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.06 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|