C24H16N2O8S3 — CID 126346631
[4-[(Z)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate (PubChem CID 126346631) has the molecular formula C24H16N2O8S3 and a molecular weight of 556.60 g/mol. Its IUPAC name is [4-[(Z)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate.
| Compound Name | [4-[(Z)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 126346631 |
| Molecular Formula | C24H16N2O8S3 |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.01 |
| IUPAC Name | [4-[(Z)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=C3\SC(=S)N(c4ccc5c(c4)OCO5)C3=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16N2O8S3/c1-14-2-8-18(12-19(14)26(28)29)37(30,31)34-17-6-3-15(4-7-17)10-22-23(27)25(24(35)36-22)16-5-9-20-21(11-16)33-13-32-20/h2-12H,13H2,1H3/b22-10- |
| InChIKey | YELXVGKBYMGCRY-YVNNLAQVSA-N |
| XLogP | 4.81 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|