C23H16N2O6S2 — CID 126350735
(5E)-3-(1,3-benzodioxol-5-yl)-5-[[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126350735) has the molecular formula C23H16N2O6S2 and a molecular weight of 480.52 g/mol. Its IUPAC name is (5E)-3-(1,3-benzodioxol-5-yl)-5-[[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(1,3-benzodioxol-5-yl)-5-[[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126350735 |
| Molecular Formula | C23H16N2O6S2 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | (5E)-3-(1,3-benzodioxol-5-yl)-5-[[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(-c2ccc(/C=C3/SC(=S)N(c4ccc5c(c4)OCO5)C3=O)o2)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C23H16N2O6S2/c1-12-7-14(8-17(13(12)2)25(27)28)18-6-4-16(31-18)10-21-22(26)24(23(32)33-21)15-3-5-19-20(9-15)30-11-29-19/h3-10H,11H2,1-2H3/b21-10+ |
| InChIKey | GYHQGFRUEKNFPW-UFFVCSGVSA-N |
| XLogP | 5.61 |
| TPSA | 95.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|