C26H22N2O7S3 — CID 126338176
[4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate (PubChem CID 126338176) has the molecular formula C26H22N2O7S3 and a molecular weight of 570.67 g/mol. Its IUPAC name is [4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate.
| Compound Name | [4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 126338176 |
| Molecular Formula | C26H22N2O7S3 |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | [4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3ccc(C)cc3C)C2=O)ccc1OS(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H22N2O7S3/c1-15-5-9-20(17(3)11-15)27-25(29)24(37-26(27)36)13-18-7-10-22(23(12-18)34-4)35-38(32,33)19-8-6-16(2)21(14-19)28(30)31/h5-14H,1-4H3/b24-13+ |
| InChIKey | PCCRXJAYZDMBPT-ZMOGYAJESA-N |
| XLogP | 5.70 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|