C25H21NO5S3 — CID 126345702
[4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] benzenesulfonate (PubChem CID 126345702) has the molecular formula C25H21NO5S3 and a molecular weight of 511.65 g/mol. Its IUPAC name is [4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] benzenesulfonate.
| Compound Name | [4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126345702 |
| Molecular Formula | C25H21NO5S3 |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | [4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] benzenesulfonate |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3ccc(C)cc3C)C2=O)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H21NO5S3/c1-16-9-11-20(17(2)13-16)26-24(27)23(33-25(26)32)15-18-10-12-21(22(14-18)30-3)31-34(28,29)19-7-5-4-6-8-19/h4-15H,1-3H3/b23-15+ |
| InChIKey | WIENHMYRIPPRNH-HZHRSRAPSA-N |
| XLogP | 5.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|