C24H19NO5S3 — CID 2271381
[4-[(E)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] benzenesulfonate (PubChem CID 2271381) has the molecular formula C24H19NO5S3 and a molecular weight of 497.62 g/mol. Its IUPAC name is [4-[(E)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] benzenesulfonate.
| Compound Name | [4-[(E)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 2271381 |
| Molecular Formula | C24H19NO5S3 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | [4-[(E)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] benzenesulfonate |
| SMILES | COc1cc(/C=C2/SC(=S)N(Cc3ccccc3)C2=O)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H19NO5S3/c1-29-21-14-18(12-13-20(21)30-33(27,28)19-10-6-3-7-11-19)15-22-23(26)25(24(31)32-22)16-17-8-4-2-5-9-17/h2-15H,16H2,1H3/b22-15+ |
| InChIKey | ZNISOIXEKPLITL-PXLXIMEGSA-N |
| XLogP | 4.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|