C23H17NO4S3 — CID 2294794
[2-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate (PubChem CID 2294794) has the molecular formula C23H17NO4S3 and a molecular weight of 467.59 g/mol. Its IUPAC name is [2-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate.
| Compound Name | [2-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 2294794 |
| Molecular Formula | C23H17NO4S3 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | [2-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate |
| SMILES | O=C1/C(=C/c2ccccc2OS(=O)(=O)c2ccccc2)SC(=S)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H17NO4S3/c25-22-21(30-23(29)24(22)16-17-9-3-1-4-10-17)15-18-11-7-8-14-20(18)28-31(26,27)19-12-5-2-6-13-19/h1-15H,16H2/b21-15- |
| InChIKey | FQKNSOLALDSEAE-QNGOZBTKSA-N |
| XLogP | 4.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|