C30H23ClN2O4S2 — CID 126088568
[2-[(E)-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-4-chlorophenyl] benzenesulfonate (PubChem CID 126088568) has the molecular formula C30H23ClN2O4S2 and a molecular weight of 575.11 g/mol. Its IUPAC name is [2-[(E)-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-4-chlorophenyl] benzenesulfonate.
| Compound Name | [2-[(E)-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-4-chlorophenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126088568 |
| Molecular Formula | C30H23ClN2O4S2 |
| Molecular Weight | 575.11 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | [2-[(E)-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-4-chlorophenyl] benzenesulfonate |
| SMILES | O=C1/C(=C\c2cc(Cl)ccc2OS(=O)(=O)c2ccccc2)S/C(=N\Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C30H23ClN2O4S2/c31-25-16-17-27(37-39(35,36)26-14-8-3-9-15-26)24(18-25)19-28-29(34)33(21-23-12-6-2-7-13-23)30(38-28)32-20-22-10-4-1-5-11-22/h1-19H,20-21H2/b28-19+,32-30- |
| InChIKey | RQYKNIWSOBZYKW-URVOCPGOSA-N |
| XLogP | 6.78 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.11 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|