C24H19NO4S3 — CID 2272196
[4-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 2272196) has the molecular formula C24H19NO4S3 and a molecular weight of 481.62 g/mol. Its IUPAC name is [4-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2272196 |
| Molecular Formula | C24H19NO4S3 |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | [4-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=C3\SC(=S)N(Cc4ccccc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C24H19NO4S3/c1-17-7-13-21(14-8-17)32(27,28)29-20-11-9-18(10-12-20)15-22-23(26)25(24(30)31-22)16-19-5-3-2-4-6-19/h2-15H,16H2,1H3/b22-15- |
| InChIKey | USAITGWSRYTCPC-JCMHNJIXSA-N |
| XLogP | 5.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|