C21H21NOS2 — CID 6376656
(5Z)-3-benzyl-5-[(4-tert-butylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6376656) has the molecular formula C21H21NOS2 and a molecular weight of 367.54 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[(4-tert-butylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-5-[(4-tert-butylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6376656 |
| Molecular Formula | C21H21NOS2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (5Z)-3-benzyl-5-[(4-tert-butylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1ccc(/C=C2\SC(=S)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H21NOS2/c1-21(2,3)17-11-9-15(10-12-17)13-18-19(23)22(20(24)25-18)14-16-7-5-4-6-8-16/h4-13H,14H2,1-3H3/b18-13- |
| InChIKey | NGMWYGDWFBNBLA-AQTBWJFISA-N |
| XLogP | 5.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|