C18H15NOS2 — CID 2271216
(5E)-3-benzyl-5-[(3-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2271216) has the molecular formula C18H15NOS2 and a molecular weight of 325.46 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[(3-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-5-[(3-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2271216 |
| Molecular Formula | C18H15NOS2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (5E)-3-benzyl-5-[(3-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(/C=C2/SC(=S)N(Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C18H15NOS2/c1-13-6-5-9-15(10-13)11-16-17(20)19(18(21)22-16)12-14-7-3-2-4-8-14/h2-11H,12H2,1H3/b16-11+ |
| InChIKey | ZPIIJSATMSNVMA-LFIBNONCSA-N |
| XLogP | 4.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|