C20H15F2NO3S2 — CID 174283042
4-[(Z)-[3-[[3-(1,1-difluoroethyl)phenyl]methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 174283042) has the molecular formula C20H15F2NO3S2 and a molecular weight of 419.47 g/mol. Its IUPAC name is 4-[(Z)-[3-[[3-(1,1-difluoroethyl)phenyl]methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[3-[[3-(1,1-difluoroethyl)phenyl]methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 174283042 |
| Molecular Formula | C20H15F2NO3S2 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 4-[(Z)-[3-[[3-(1,1-difluoroethyl)phenyl]methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | CC(F)(F)c1cccc(CN2C(=O)/C(=C/c3ccc(C(=O)O)cc3)SC2=S)c1 |
| InChI | InChI=1S/C20H15F2NO3S2/c1-20(21,22)15-4-2-3-13(9-15)11-23-17(24)16(28-19(23)27)10-12-5-7-14(8-6-12)18(25)26/h2-10H,11H2,1H3,(H,25,26)/b16-10- |
| InChIKey | RLKHHNFIVBPAMR-YBEGLDIGSA-N |
| XLogP | 4.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|