C22H19F3N2O3S — CID 42871365
4-[(Z)-[2,4-dioxo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]-N-ethyl-N-methylbenzamide (PubChem CID 42871365) has the molecular formula C22H19F3N2O3S and a molecular weight of 448.47 g/mol. Its IUPAC name is 4-[(Z)-[2,4-dioxo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]-N-ethyl-N-methylbenzamide.
| Compound Name | 4-[(Z)-[2,4-dioxo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]-N-ethyl-N-methylbenzamide |
|---|---|
| PubChem CID | 42871365 |
| Molecular Formula | C22H19F3N2O3S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 4-[(Z)-[2,4-dioxo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]-N-ethyl-N-methylbenzamide |
| SMILES | CCN(C)C(=O)c1ccc(/C=C2\SC(=O)N(Cc3cccc(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H19F3N2O3S/c1-3-26(2)19(28)16-9-7-14(8-10-16)12-18-20(29)27(21(30)31-18)13-15-5-4-6-17(11-15)22(23,24)25/h4-12H,3,13H2,1-2H3/b18-12- |
| InChIKey | UYKPGWHFVAWTRJ-PDGQHHTCSA-N |
| XLogP | 5.03 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|