C18H12F3NO4S — CID 74019929
5-[(2,3-dihydroxyphenyl)methylidene]-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 74019929) has the molecular formula C18H12F3NO4S and a molecular weight of 395.36 g/mol. Its IUPAC name is 5-[(2,3-dihydroxyphenyl)methylidene]-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(2,3-dihydroxyphenyl)methylidene]-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 74019929 |
| Molecular Formula | C18H12F3NO4S |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 5-[(2,3-dihydroxyphenyl)methylidene]-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2cccc(O)c2O)C(=O)N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12F3NO4S/c19-18(20,21)12-5-1-3-10(7-12)9-22-16(25)14(27-17(22)26)8-11-4-2-6-13(23)15(11)24/h1-8,23-24H,9H2 |
| InChIKey | HUOFWRDEIAMWAN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|