C21H16F4N2O3S — CID 26895390
N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 26895390) has the molecular formula C21H16F4N2O3S and a molecular weight of 452.43 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 26895390 |
| Molecular Formula | C21H16F4N2O3S |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)NCCN1C(=O)S/C(=C\c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C21H16F4N2O3S/c22-16-6-4-13(5-7-16)11-17-19(29)27(20(30)31-17)9-8-26-18(28)12-14-2-1-3-15(10-14)21(23,24)25/h1-7,10-11H,8-9,12H2,(H,26,28)/b17-11- |
| InChIKey | VYXKVQNQDCUYQF-BOPFTXTBSA-N |
| XLogP | 4.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|