C21H17F3N2O3S — CID 3335031
2-[5-[(4-ethylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 3335031) has the molecular formula C21H17F3N2O3S and a molecular weight of 434.44 g/mol. Its IUPAC name is 2-[5-[(4-ethylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[5-[(4-ethylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3335031 |
| Molecular Formula | C21H17F3N2O3S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-[5-[(4-ethylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCc1ccc(C=C2SC(=O)N(CC(=O)Nc3cccc(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H17F3N2O3S/c1-2-13-6-8-14(9-7-13)10-17-19(28)26(20(29)30-17)12-18(27)25-16-5-3-4-15(11-16)21(22,23)24/h3-11H,2,12H2,1H3,(H,25,27) |
| InChIKey | SJDBHMPYCQIXHC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|