C29H26F2N2O5S — CID 42871416
4-[(Z)-[3-[(2,6-difluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbenzamide (PubChem CID 42871416) has the molecular formula C29H26F2N2O5S and a molecular weight of 552.60 g/mol. Its IUPAC name is 4-[(Z)-[3-[(2,6-difluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbenzamide.
| Compound Name | 4-[(Z)-[3-[(2,6-difluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 42871416 |
| Molecular Formula | C29H26F2N2O5S |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 4-[(Z)-[3-[(2,6-difluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbenzamide |
| SMILES | COc1ccc(CCN(C)C(=O)c2ccc(/C=C3\SC(=O)N(Cc4c(F)cccc4F)C3=O)cc2)cc1OC |
| InChI | InChI=1S/C29H26F2N2O5S/c1-32(14-13-19-9-12-24(37-2)25(15-19)38-3)27(34)20-10-7-18(8-11-20)16-26-28(35)33(29(36)39-26)17-21-22(30)5-4-6-23(21)31/h4-12,15-16H,13-14,17H2,1-3H3/b26-16- |
| InChIKey | DEPPZRZRHNDNKH-QQXSKIMKSA-N |
| XLogP | 5.53 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|