C16H19NO4S3 — CID 75366357
2-[(5E)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid (PubChem CID 75366357) has the molecular formula C16H19NO4S3 and a molecular weight of 385.53 g/mol. Its IUPAC name is 2-[(5E)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid.
| Compound Name | 2-[(5E)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 75366357 |
| Molecular Formula | C16H19NO4S3 |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-[(5E)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(/C=C2/SC(=S)N(CCS(=O)(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C16H19NO4S3/c1-16(2,3)12-6-4-11(5-7-12)10-13-14(18)17(15(22)23-13)8-9-24(19,20)21/h4-7,10H,8-9H2,1-3H3,(H,19,20,21)/b13-10+ |
| InChIKey | QSBMHBTZSCHOLR-JLHYYAGUSA-N |
| XLogP | 3.07 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|