C12H9Cl2NO4S3 — CID 2133113
2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid (PubChem CID 2133113) has the molecular formula C12H9Cl2NO4S3 and a molecular weight of 398.31 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid.
| Compound Name | 2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 2133113 |
| Molecular Formula | C12H9Cl2NO4S3 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 396.91 |
| IUPAC Name | 2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
| SMILES | O=C1/C(=C/c2ccc(Cl)c(Cl)c2)SC(=S)N1CCS(=O)(=O)O |
| InChI | InChI=1S/C12H9Cl2NO4S3/c13-8-2-1-7(5-9(8)14)6-10-11(16)15(12(20)21-10)3-4-22(17,18)19/h1-2,5-6H,3-4H2,(H,17,18,19)/b10-6- |
| InChIKey | ZRUKJLTVESYRFB-POHAHGRESA-N |
| XLogP | 3.08 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|