C11H10N2O4S3 — CID 4515299
2-[4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid (PubChem CID 4515299) has the molecular formula C11H10N2O4S3 and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-[4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid.
| Compound Name | 2-[4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 4515299 |
| Molecular Formula | C11H10N2O4S3 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 2-[4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
| SMILES | O=C1C(=Cc2ccccn2)SC(=S)N1CCS(=O)(=O)O |
| InChI | InChI=1S/C11H10N2O4S3/c14-10-9(7-8-3-1-2-4-12-8)19-11(18)13(10)5-6-20(15,16)17/h1-4,7H,5-6H2,(H,15,16,17) |
| InChIKey | PMVJXTXBPXBYHD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|