C18H22N2O3S2 — CID 5190824
propan-2-yl 6-[4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 5190824) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is propan-2-yl 6-[4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | propan-2-yl 6-[4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 5190824 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | propan-2-yl 6-[4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | CC(C)OC(=O)CCCCCN1C(=O)C(=Cc2ccccn2)SC1=S |
| InChI | InChI=1S/C18H22N2O3S2/c1-13(2)23-16(21)9-4-3-7-11-20-17(22)15(25-18(20)24)12-14-8-5-6-10-19-14/h5-6,8,10,12-13H,3-4,7,9,11H2,1-2H3 |
| InChIKey | KPFDMBDFVHMNDI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|