C21H29NO6S3 — CID 4514461
2-[5-[(3-methoxy-4-octoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid (PubChem CID 4514461) has the molecular formula C21H29NO6S3 and a molecular weight of 487.67 g/mol. Its IUPAC name is 2-[5-[(3-methoxy-4-octoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid.
| Compound Name | 2-[5-[(3-methoxy-4-octoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 4514461 |
| Molecular Formula | C21H29NO6S3 |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2-[5-[(3-methoxy-4-octoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
| SMILES | CCCCCCCCOc1ccc(C=C2SC(=S)N(CCS(=O)(=O)O)C2=O)cc1OC |
| InChI | InChI=1S/C21H29NO6S3/c1-3-4-5-6-7-8-12-28-17-10-9-16(14-18(17)27-2)15-19-20(23)22(21(29)30-19)11-13-31(24,25)26/h9-10,14-15H,3-8,11-13H2,1-2H3,(H,24,25,26) |
| InChIKey | NZGRDDLGKDTDBI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|