C25H33NO5S2 — CID 19182790
cyclohexyl 2-[(5Z)-5-[(4-hexoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 19182790) has the molecular formula C25H33NO5S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is cyclohexyl 2-[(5Z)-5-[(4-hexoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | cyclohexyl 2-[(5Z)-5-[(4-hexoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 19182790 |
| Molecular Formula | C25H33NO5S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | cyclohexyl 2-[(5Z)-5-[(4-hexoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCCCCOc1ccc(/C=C2\SC(=S)N(CC(=O)OC3CCCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C25H33NO5S2/c1-3-4-5-9-14-30-20-13-12-18(15-21(20)29-2)16-22-24(28)26(25(32)33-22)17-23(27)31-19-10-7-6-8-11-19/h12-13,15-16,19H,3-11,14,17H2,1-2H3/b22-16- |
| InChIKey | DJRWNGHRSSHPAG-JWGURIENSA-N |
| XLogP | 5.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|