C20H23NO5S2 — CID 1405131
cyclohexyl 2-[5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 1405131) has the molecular formula C20H23NO5S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is cyclohexyl 2-[5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | cyclohexyl 2-[5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 1405131 |
| Molecular Formula | C20H23NO5S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | cyclohexyl 2-[5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1ccc(C=C2SC(=S)N(CC(=O)OC3CCCCC3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C20H23NO5S2/c1-24-15-9-8-13(16(11-15)25-2)10-17-19(23)21(20(27)28-17)12-18(22)26-14-6-4-3-5-7-14/h8-11,14H,3-7,12H2,1-2H3 |
| InChIKey | NNNMBNHSIYPAHS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|