C16H16BrNO4S2 — CID 19183266
cyclohexyl 2-[(5Z)-5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 19183266) has the molecular formula C16H16BrNO4S2 and a molecular weight of 430.35 g/mol. Its IUPAC name is cyclohexyl 2-[(5Z)-5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | cyclohexyl 2-[(5Z)-5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 19183266 |
| Molecular Formula | C16H16BrNO4S2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 428.97 |
| IUPAC Name | cyclohexyl 2-[(5Z)-5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccc(Br)o2)SC1=S)OC1CCCCC1 |
| InChI | InChI=1S/C16H16BrNO4S2/c17-13-7-6-11(21-13)8-12-15(20)18(16(23)24-12)9-14(19)22-10-4-2-1-3-5-10/h6-8,10H,1-5,9H2/b12-8- |
| InChIKey | NJXHFMYHCSBZJF-WQLSENKSSA-N |
| XLogP | 4.12 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|