C24H23FN2O3S2 — CID 18808327
2-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 18808327) has the molecular formula C24H23FN2O3S2 and a molecular weight of 470.59 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 18808327 |
| Molecular Formula | C24H23FN2O3S2 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccccc2OC2CCCCC2)SC1=S)Nc1ccccc1F |
| InChI | InChI=1S/C24H23FN2O3S2/c25-18-11-5-6-12-19(18)26-22(28)15-27-23(29)21(32-24(27)31)14-16-8-4-7-13-20(16)30-17-9-2-1-3-10-17/h4-8,11-14,17H,1-3,9-10,15H2,(H,26,28)/b21-14- |
| InChIKey | CWGPHHSIABRMQI-STZFKDTASA-N |
| XLogP | 5.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|