C21H21ClN4O3S3 — CID 18807868
N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-2-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide (PubChem CID 18807868) has the molecular formula C21H21ClN4O3S3 and a molecular weight of 509.08 g/mol. Its IUPAC name is N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-2-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-2-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 18807868 |
| Molecular Formula | C21H21ClN4O3S3 |
| Molecular Weight | 509.08 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-2-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccccc2OC2CCCCC2)SC1=S)Nc1nnc(CCl)s1 |
| InChI | InChI=1S/C21H21ClN4O3S3/c22-11-18-24-25-20(32-18)23-17(27)12-26-19(28)16(31-21(26)30)10-13-6-4-5-9-15(13)29-14-7-2-1-3-8-14/h4-6,9-10,14H,1-3,7-8,11-12H2,(H,23,25,27)/b16-10- |
| InChIKey | XEOHHIMJZUCOFB-YBEGLDIGSA-N |
| XLogP | 4.83 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.08 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|