C23H25ClN4O4S3 — CID 18807865
N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-3-[(5Z)-5-[(4-cyclohexyloxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 18807865) has the molecular formula C23H25ClN4O4S3 and a molecular weight of 553.13 g/mol. Its IUPAC name is N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-3-[(5Z)-5-[(4-cyclohexyloxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-3-[(5Z)-5-[(4-cyclohexyloxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 18807865 |
| Molecular Formula | C23H25ClN4O4S3 |
| Molecular Weight | 553.13 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-3-[(5Z)-5-[(4-cyclohexyloxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(CCC(=O)Nc3nnc(CCl)s3)C2=O)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C23H25ClN4O4S3/c1-31-17-11-14(7-8-16(17)32-15-5-3-2-4-6-15)12-18-21(30)28(23(33)34-18)10-9-19(29)25-22-27-26-20(13-24)35-22/h7-8,11-12,15H,2-6,9-10,13H2,1H3,(H,25,27,29)/b18-12- |
| InChIKey | WLQIAWFGDWRQGH-PDGQHHTCSA-N |
| XLogP | 5.23 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.13 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|