C29H27Cl2N3O4S3 — CID 18807996
2-[(5Z)-5-[(4-cyclohexyloxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 18807996) has the molecular formula C29H27Cl2N3O4S3 and a molecular weight of 648.66 g/mol. Its IUPAC name is 2-[(5Z)-5-[(4-cyclohexyloxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(5Z)-5-[(4-cyclohexyloxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 18807996 |
| Molecular Formula | C29H27Cl2N3O4S3 |
| Molecular Weight | 648.66 g/mol |
| Exact Mass | 647.05 |
| IUPAC Name | 2-[(5Z)-5-[(4-cyclohexyloxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(CC(=O)Nc3ncc(Cc4cccc(Cl)c4Cl)s3)C2=O)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C29H27Cl2N3O4S3/c1-37-23-12-17(10-11-22(23)38-19-7-3-2-4-8-19)13-24-27(36)34(29(39)41-24)16-25(35)33-28-32-15-20(40-28)14-18-6-5-9-21(30)26(18)31/h5-6,9-13,15,19H,2-4,7-8,14,16H2,1H3,(H,32,33,35)/b24-13- |
| InChIKey | UOHUIAVEADVNDE-CFRMEGHHSA-N |
| XLogP | 7.60 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.66 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|