C26H22ClN3O4S3 — CID 6203011
methyl 4-[(Z)-[3-[4-[[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 6203011) has the molecular formula C26H22ClN3O4S3 and a molecular weight of 572.13 g/mol. Its IUPAC name is methyl 4-[(Z)-[3-[4-[[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[3-[4-[[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 6203011 |
| Molecular Formula | C26H22ClN3O4S3 |
| Molecular Weight | 572.13 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | methyl 4-[(Z)-[3-[4-[[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2\SC(=S)N(CCCC(=O)Nc3ncc(Cc4ccccc4Cl)s3)C2=O)cc1 |
| InChI | InChI=1S/C26H22ClN3O4S3/c1-34-24(33)17-10-8-16(9-11-17)13-21-23(32)30(26(35)37-21)12-4-7-22(31)29-25-28-15-19(36-25)14-18-5-2-3-6-20(18)27/h2-3,5-6,8-11,13,15H,4,7,12,14H2,1H3,(H,28,29,31)/b21-13- |
| InChIKey | KFRHZDMSUSQWGP-BKUYFWCQSA-N |
| XLogP | 5.79 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.13 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|