C21H19N3O4S2 — CID 1316086
methyl 4-[(E)-[4-oxo-3-[4-oxo-4-(pyridin-3-ylamino)butyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 1316086) has the molecular formula C21H19N3O4S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is methyl 4-[(E)-[4-oxo-3-[4-oxo-4-(pyridin-3-ylamino)butyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(E)-[4-oxo-3-[4-oxo-4-(pyridin-3-ylamino)butyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 1316086 |
| Molecular Formula | C21H19N3O4S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | methyl 4-[(E)-[4-oxo-3-[4-oxo-4-(pyridin-3-ylamino)butyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2/SC(=S)N(CCCC(=O)Nc3cccnc3)C2=O)cc1 |
| InChI | InChI=1S/C21H19N3O4S2/c1-28-20(27)15-8-6-14(7-9-15)12-17-19(26)24(21(29)30-17)11-3-5-18(25)23-16-4-2-10-22-13-16/h2,4,6-10,12-13H,3,5,11H2,1H3,(H,23,25)/b17-12+ |
| InChIKey | BPBPXHFINDVGNI-SFQUDFHCSA-N |
| XLogP | 3.49 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|