C26H22N2O4S2 — CID 6202980
methyl 4-[(Z)-[3-[4-(naphthalen-1-ylamino)-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 6202980) has the molecular formula C26H22N2O4S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is methyl 4-[(Z)-[3-[4-(naphthalen-1-ylamino)-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[3-[4-(naphthalen-1-ylamino)-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 6202980 |
| Molecular Formula | C26H22N2O4S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | methyl 4-[(Z)-[3-[4-(naphthalen-1-ylamino)-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2\SC(=S)N(CCCC(=O)Nc3cccc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C26H22N2O4S2/c1-32-25(31)19-13-11-17(12-14-19)16-22-24(30)28(26(33)34-22)15-5-10-23(29)27-21-9-4-7-18-6-2-3-8-20(18)21/h2-4,6-9,11-14,16H,5,10,15H2,1H3,(H,27,29)/b22-16- |
| InChIKey | ZXUOYXZPJSDNGA-JWGURIENSA-N |
| XLogP | 5.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|