C26H32N4O3S3 — CID 18807849
6-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)hexanamide (PubChem CID 18807849) has the molecular formula C26H32N4O3S3 and a molecular weight of 544.77 g/mol. Its IUPAC name is 6-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)hexanamide.
| Compound Name | 6-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 18807849 |
| Molecular Formula | C26H32N4O3S3 |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 6-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)hexanamide |
| SMILES | CCc1nnc(NC(=O)CCCCCN2C(=O)/C(=C/c3ccccc3OC3CCCCC3)SC2=S)s1 |
| InChI | InChI=1S/C26H32N4O3S3/c1-2-23-28-29-25(36-23)27-22(31)15-7-4-10-16-30-24(32)21(35-26(30)34)17-18-11-8-9-14-20(18)33-19-12-5-3-6-13-19/h8-9,11,14,17,19H,2-7,10,12-13,15-16H2,1H3,(H,27,29,31)/b21-17- |
| InChIKey | LJKQRHCJGLMDHD-FXBPSFAMSA-N |
| XLogP | 6.21 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|