C29H27N5O4S4 — CID 18807913
N-[5-(1,3-benzoxazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 18807913) has the molecular formula C29H27N5O4S4 and a molecular weight of 637.83 g/mol. Its IUPAC name is N-[5-(1,3-benzoxazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-[5-(1,3-benzoxazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 18807913 |
| Molecular Formula | C29H27N5O4S4 |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 637.09 |
| IUPAC Name | N-[5-(1,3-benzoxazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-[(5Z)-5-[(2-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | O=C(CCN1C(=O)/C(=C/c2ccccc2OC2CCCCC2)SC1=S)Nc1nnc(CSc2nc3ccccc3o2)s1 |
| InChI | InChI=1S/C29H27N5O4S4/c35-24(31-27-33-32-25(42-27)17-40-28-30-20-11-5-7-13-22(20)38-28)14-15-34-26(36)23(41-29(34)39)16-18-8-4-6-12-21(18)37-19-9-2-1-3-10-19/h4-8,11-13,16,19H,1-3,9-10,14-15,17H2,(H,31,33,35)/b23-16- |
| InChIKey | GRECIUQRBYVNOX-KQWNVCNZSA-N |
| XLogP | 6.91 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|