C24H20N4O4S3 — CID 6531577
N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide (PubChem CID 6531577) has the molecular formula C24H20N4O4S3 and a molecular weight of 524.65 g/mol. Its IUPAC name is N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide.
| Compound Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide |
|---|---|
| PubChem CID | 6531577 |
| Molecular Formula | C24H20N4O4S3 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide |
| SMILES | O=C(CCN1C(=O)/C(=C/C=C/c2ccccc2)SC1=S)NNC(=O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C24H20N4O4S3/c29-20(26-27-21(30)15-34-23-25-17-10-4-5-11-18(17)32-23)13-14-28-22(31)19(35-24(28)33)12-6-9-16-7-2-1-3-8-16/h1-12H,13-15H2,(H,26,29)(H,27,30)/b9-6+,19-12- |
| InChIKey | VJZLQJVGISZOQF-MUFYDRSQSA-N |
| XLogP | 3.91 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|