C25H22N4O3S4 — CID 6531606
N'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide (PubChem CID 6531606) has the molecular formula C25H22N4O3S4 and a molecular weight of 554.74 g/mol. Its IUPAC name is N'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide.
| Compound Name | N'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide |
|---|---|
| PubChem CID | 6531606 |
| Molecular Formula | C25H22N4O3S4 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | N'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide |
| SMILES | O=C(CCCN1C(=O)/C(=C/C=C/c2ccccc2)SC1=S)NNC(=O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C25H22N4O3S4/c30-21(27-28-22(31)16-34-24-26-18-11-4-5-12-19(18)35-24)14-7-15-29-23(32)20(36-25(29)33)13-6-10-17-8-2-1-3-9-17/h1-6,8-13H,7,14-16H2,(H,27,30)(H,28,31)/b10-6+,20-13- |
| InChIKey | YUHTYFBWZFOTAD-OJZYNGEUSA-N |
| XLogP | 4.77 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|