C27H28N4O5S4 — CID 6203679
N'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanehydrazide (PubChem CID 6203679) has the molecular formula C27H28N4O5S4 and a molecular weight of 616.81 g/mol. Its IUPAC name is N'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanehydrazide.
| Compound Name | N'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanehydrazide |
|---|---|
| PubChem CID | 6203679 |
| Molecular Formula | C27H28N4O5S4 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.09 |
| IUPAC Name | N'-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]-6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanehydrazide |
| SMILES | COc1ccc(/C=C2\SC(=S)N(CCCCCC(=O)NNC(=O)CSc3nc4ccccc4s3)C2=O)cc1OC |
| InChI | InChI=1S/C27H28N4O5S4/c1-35-19-12-11-17(14-20(19)36-2)15-22-25(34)31(27(37)40-22)13-7-3-4-10-23(32)29-30-24(33)16-38-26-28-18-8-5-6-9-21(18)39-26/h5-6,8-9,11-12,14-15H,3-4,7,10,13,16H2,1-2H3,(H,29,32)(H,30,33)/b22-15- |
| InChIKey | WRGJJWUWHYZJDP-JCMHNJIXSA-N |
| XLogP | 5.01 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|