C25H27N3O6S2 — CID 4759258
N'-[6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-4-hydroxybenzohydrazide (PubChem CID 4759258) has the molecular formula C25H27N3O6S2 and a molecular weight of 529.64 g/mol. Its IUPAC name is N'-[6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-4-hydroxybenzohydrazide.
| Compound Name | N'-[6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-4-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 4759258 |
| Molecular Formula | C25H27N3O6S2 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | N'-[6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-4-hydroxybenzohydrazide |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCCCC(=O)NNC(=O)c3ccc(O)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C25H27N3O6S2/c1-33-19-12-7-16(14-20(19)34-2)15-21-24(32)28(25(35)36-21)13-5-3-4-6-22(30)26-27-23(31)17-8-10-18(29)11-9-17/h7-12,14-15,29H,3-6,13H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | BXVVWIARKZZDNH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|