C28H36N2O4S2 — CID 4759241
N-(1-adamantyl)-6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide (PubChem CID 4759241) has the molecular formula C28H36N2O4S2 and a molecular weight of 528.74 g/mol. Its IUPAC name is N-(1-adamantyl)-6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide.
| Compound Name | N-(1-adamantyl)-6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 4759241 |
| Molecular Formula | C28H36N2O4S2 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | N-(1-adamantyl)-6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCCCC(=O)NC34CC5CC(CC(C5)C3)C4)C2=O)cc1OC |
| InChI | InChI=1S/C28H36N2O4S2/c1-33-22-8-7-18(13-23(22)34-2)14-24-26(32)30(27(35)36-24)9-5-3-4-6-25(31)29-28-15-19-10-20(16-28)12-21(11-19)17-28/h7-8,13-14,19-21H,3-6,9-12,15-17H2,1-2H3,(H,29,31) |
| InChIKey | JNQYTSPSIPUGNX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|