C26H32N2O5S2 — CID 2886039
N-(1-adamantyl)-3-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanamide (PubChem CID 2886039) has the molecular formula C26H32N2O5S2 and a molecular weight of 516.69 g/mol. Its IUPAC name is N-(1-adamantyl)-3-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(1-adamantyl)-3-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 2886039 |
| Molecular Formula | C26H32N2O5S2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | N-(1-adamantyl)-3-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanamide |
| SMILES | COc1cc(C=C2SC(=S)N(CCC(=O)NC34CC5CC(CC(C5)C3)C4)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H32N2O5S2/c1-31-19-9-15(10-20(32-2)23(19)33-3)11-21-24(30)28(25(34)35-21)5-4-22(29)27-26-12-16-6-17(13-26)8-18(7-16)14-26/h9-11,16-18H,4-8,12-14H2,1-3H3,(H,27,29) |
| InChIKey | NCZGQNSUPDHDLJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|