C24H26N2O5S2 — CID 3137339
N-(3,4-dimethylphenyl)-3-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanamide (PubChem CID 3137339) has the molecular formula C24H26N2O5S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(3,4-dimethylphenyl)-3-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 3137339 |
| Molecular Formula | C24H26N2O5S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanamide |
| SMILES | COc1cc(C=C2SC(=S)N(CCC(=O)Nc3ccc(C)c(C)c3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H26N2O5S2/c1-14-6-7-17(10-15(14)2)25-21(27)8-9-26-23(28)20(33-24(26)32)13-16-11-18(29-3)22(31-5)19(12-16)30-4/h6-7,10-13H,8-9H2,1-5H3,(H,25,27) |
| InChIKey | SEVYZBKEPIUCLW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|