C21H25N3O4S3 — CID 34063889
N-(4,5-dihydro-1,3-thiazol-2-yl)-6-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide (PubChem CID 34063889) has the molecular formula C21H25N3O4S3 and a molecular weight of 479.65 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-6-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-6-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 34063889 |
| Molecular Formula | C21H25N3O4S3 |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-6-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
| SMILES | COc1ccc(/C=C2/SC(=S)N(CCCCCC(=O)NC3=NCCS3)C2=O)cc1OC |
| InChI | InChI=1S/C21H25N3O4S3/c1-27-15-8-7-14(12-16(15)28-2)13-17-19(26)24(21(29)31-17)10-5-3-4-6-18(25)23-20-22-9-11-30-20/h7-8,12-13H,3-6,9-11H2,1-2H3,(H,22,23,25)/b17-13+ |
| InChIKey | NXUREKIKYQSGJW-GHRIWEEISA-N |
| XLogP | 3.68 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|