C23H22ClN3O5S2 — CID 6202877
3-chloro-N'-[4-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide (PubChem CID 6202877) has the molecular formula C23H22ClN3O5S2 and a molecular weight of 520.03 g/mol. Its IUPAC name is 3-chloro-N'-[4-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide.
| Compound Name | 3-chloro-N'-[4-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 6202877 |
| Molecular Formula | C23H22ClN3O5S2 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 3-chloro-N'-[4-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide |
| SMILES | COc1ccc(/C=C2\SC(=S)N(CCCC(=O)NNC(=O)c3cccc(Cl)c3)C2=O)cc1OC |
| InChI | InChI=1S/C23H22ClN3O5S2/c1-31-17-9-8-14(11-18(17)32-2)12-19-22(30)27(23(33)34-19)10-4-7-20(28)25-26-21(29)15-5-3-6-16(24)13-15/h3,5-6,8-9,11-13H,4,7,10H2,1-2H3,(H,25,28)(H,26,29)/b19-12- |
| InChIKey | VIMKZAPJQFBXDR-UNOMPAQXSA-N |
| XLogP | 3.80 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|