C21H19N3O6S2 — CID 4758105
N'-[2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-4-hydroxybenzohydrazide (PubChem CID 4758105) has the molecular formula C21H19N3O6S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is N'-[2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-4-hydroxybenzohydrazide.
| Compound Name | N'-[2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-4-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 4758105 |
| Molecular Formula | C21H19N3O6S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | N'-[2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-4-hydroxybenzohydrazide |
| SMILES | COc1ccc(C=C2SC(=S)N(CC(=O)NNC(=O)c3ccc(O)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C21H19N3O6S2/c1-29-15-8-3-12(9-16(15)30-2)10-17-20(28)24(21(31)32-17)11-18(26)22-23-19(27)13-4-6-14(25)7-5-13/h3-10,25H,11H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | RWTQVOKUAONAOR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|