C19H24N4O4S2 — CID 1206074
2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylpiperazin-1-yl)acetamide (PubChem CID 1206074) has the molecular formula C19H24N4O4S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | 2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 1206074 |
| Molecular Formula | C19H24N4O4S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylpiperazin-1-yl)acetamide |
| SMILES | COc1ccc(C=C2SC(=S)N(CC(=O)NN3CCN(C)CC3)C2=O)cc1OC |
| InChI | InChI=1S/C19H24N4O4S2/c1-21-6-8-22(9-7-21)20-17(24)12-23-18(25)16(29-19(23)28)11-13-4-5-14(26-2)15(10-13)27-3/h4-5,10-11H,6-9,12H2,1-3H3,(H,20,24) |
| InChIKey | QKULZTQRYPJEHZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|